bis(3-methoxy-6-methylpyridin-2-yl)methanone
bis(3-methoxy-6-methylpyridin-2-yl)methanone structure
|
Common Name | bis(3-methoxy-6-methylpyridin-2-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 824393-63-7 | Molecular Weight | 272.29900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | bis(3-methoxy-6-methylpyridin-2-yl)methanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H16N2O3 |
|---|---|
| Molecular Weight | 272.29900 |
| Exact Mass | 272.11600 |
| PSA | 61.31000 |
| LogP | 2.34160 |
| InChIKey | DWIVORRYXORCFS-UHFFFAOYSA-N |
| SMILES | COc1ccc(C)nc1C(=O)c1nc(C)ccc1OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~99%
bis(3-methoxy-6... CAS#:824393-63-7 |
| Literature: Gotchev, Dimitar B.; Comins, Daniel L. Tetrahedron, 2004 , vol. 60, # 51 p. 11751 - 11758 |
|
~%
bis(3-methoxy-6... CAS#:824393-63-7 |
| Literature: Gotchev, Dimitar B.; Comins, Daniel L. Tetrahedron, 2004 , vol. 60, # 51 p. 11751 - 11758 |
|
~%
bis(3-methoxy-6... CAS#:824393-63-7 |
| Literature: Gotchev, Dimitar B.; Comins, Daniel L. Tetrahedron, 2004 , vol. 60, # 51 p. 11751 - 11758 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 1 | |
CAS#:824393-64-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| bis-(3-methoxy-6-methylpyridin-2-yl)methanone |
| Methanone,bis(3-methoxy-6-methyl-2-pyridinyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 824393-63-7? |
| A: Chinese name of 824393-63-7 is 824393-63-7. |
| Q: What is the SMILES notation of bis(3-methoxy-6-methylpyridin-2-yl)methanone? |
| A: SMILES notation of bis(3-methoxy-6-methylpyridin-2-yl)methanone is COc1ccc(C)nc1C(=O)c1nc(C)ccc1OC. |
| Q: What is the CAS number of bis(3-methoxy-6-methylpyridin-2-yl)methanone? |
| A: CAS number of bis(3-methoxy-6-methylpyridin-2-yl)methanone is 824393-63-7. |
| Q: What is the molecular formula of bis(3-methoxy-6-methylpyridin-2-yl)methanone? |
| A: Molecular formula of bis(3-methoxy-6-methylpyridin-2-yl)methanone is C15H16N2O3. |
| Q: What is the polar surface area (PSA) of bis(3-methoxy-6-methylpyridin-2-yl)methanone? |
| A: Polar surface area (PSA) of bis(3-methoxy-6-methylpyridin-2-yl)methanone is 61.31000. |
| Q: What are the upstream materials of bis(3-methoxy-6-methylpyridin-2-yl)methanone? |
| A: Related upstream materials(CAS) of bis(3-methoxy-6-methylpyridin-2-yl)methanone: 824393-62-6;154497-82-2;139549-07-8. |
| Q: What is the InChIKey of bis(3-methoxy-6-methylpyridin-2-yl)methanone? |
| A: InChIKey of bis(3-methoxy-6-methylpyridin-2-yl)methanone is DWIVORRYXORCFS-UHFFFAOYSA-N. |
| Q: What is the LogP of bis(3-methoxy-6-methylpyridin-2-yl)methanone? |
| A: LogP of bis(3-methoxy-6-methylpyridin-2-yl)methanone is 2.34160. |
| Q: What is the molecular weight of bis(3-methoxy-6-methylpyridin-2-yl)methanone? |
| A: Molecular weight of bis(3-methoxy-6-methylpyridin-2-yl)methanone is 272.29900. |
| Q: What English synonyms does bis(3-methoxy-6-methylpyridin-2-yl)methanone have? |
| A: English synonyms of bis(3-methoxy-6-methylpyridin-2-yl)methanone: bis-(3-methoxy-6-methylpyridin-2-yl)methanone, Methanone,bis(3-methoxy-6-methyl-2-pyridinyl). |