1,5-dimethyl-2-phenyl-4-propan-2-ylpyrazol-3-one,2-ethoxybenzamide,1,3,7-trimethylpurine-2,6-dione structure
|
Common Name | 1,5-dimethyl-2-phenyl-4-propan-2-ylpyrazol-3-one,2-ethoxybenzamide,1,3,7-trimethylpurine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 82464-70-8 | Molecular Weight | 589.68500 | |
| Density | N/A | Boiling Point | 319ºC at 760 mmHg | |
| Molecular Formula | C31H39N7O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.8ºC | |
| Name | 1,5-dimethyl-2-phenyl-4-propan-2-ylpyrazol-3-one,2-ethoxybenzamide,1,3,7-trimethylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 319ºC at 760 mmHg |
|---|---|
| Molecular Formula | C31H39N7O5 |
| Molecular Weight | 589.68500 |
| Flash Point | 123.8ºC |
| Exact Mass | 589.30100 |
| PSA | 142.06000 |
| LogP | 3.64690 |
| InChIKey | DVULLFCASSYCQU-UHFFFAOYSA-N |
| SMILES | CCOc1ccccc1C(N)=O.Cc1c(C(C)C)c(=O)n(-c2ccccc2)n1C.Cn1c(=O)c2c(ncn2C)n(C)c1=O |
| Benzamide,2-ethoxy-,mixt. with 1,2-dihydro-1,5-dimethyl-4-(1-methylethyl)-2-phenyl-3H-pyrazol-3-one and 3,7-dihydro-1,3,7-trimethyl-1H-purine-2,6-dione hydrate (3:5:1) |
| Isopropylantipyrine mixed with ethenzamide and caffeine monohydrate (3:5:1) |
| Ro 04-7683 |
| 1,5-dimethyl-2-phenyl-4-propan-2-ylpyrazol-3-one |