1,2,4-Triazolidine-3,5-dione,1-[4-methyl-1-(1-methylethenyl)-2-oxo-3-cyclohexen-1-yl]-4-phenyl- structure
|
Common Name | 1,2,4-Triazolidine-3,5-dione,1-[4-methyl-1-(1-methylethenyl)-2-oxo-3-cyclohexen-1-yl]-4-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 82511-80-6 | Molecular Weight | 325.36200 | |
| Density | 1.271g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H19N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-methyl-2-oxo-1-prop-1-en-2-ylcyclohex-3-en-1-yl)-4-phenyl-1,2,4-triazolidine-3,5-dione |
|---|
| Density | 1.271g/cm3 |
|---|---|
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.36200 |
| Exact Mass | 325.14300 |
| PSA | 76.86000 |
| LogP | 1.90790 |
| Index of Refraction | 1.602 |
| InChIKey | RNNMSVVKICWCSS-UHFFFAOYSA-N |
| SMILES | C=C(C)C1(n2[nH]c(=O)n(-c3ccccc3)c2=O)CCC(C)=CC1=O |
|
~56%
1,2,4-Triazolid... CAS#:82511-80-6 |
| Literature: Hunter, Norman Robert; Krawchuk, Bert Paul; Shiloff, Janice Deborah Canadian Journal of Chemistry, 1982 , vol. 60, p. 835 - 839 |
|
~64%
1,2,4-Triazolid... CAS#:82511-80-6 |
| Literature: Oshikawa, Tatsuo; Yamashita, Mitsuji Bulletin of the Chemical Society of Japan, 1983 , vol. 56, # 9 p. 2857 - 2858 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |