cefteram pivoxil structure
|
Common Name | cefteram pivoxil | ||
|---|---|---|---|---|
| CAS Number | 82547-81-7 | Molecular Weight | 593.63600 | |
| Density | 1.66 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C22H27N9O7S2 | Melting Point | 125-128ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of cefteram pivoxilCefteram pivoxil (Ro 19-5248), an orally active cephalosporin antibiotic, is used for bacterial infections[1]. |
| Name | Cefteram pivoxil |
|---|---|
| Synonym | More Synonyms |
| Description | Cefteram pivoxil (Ro 19-5248), an orally active cephalosporin antibiotic, is used for bacterial infections[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.66 g/cm3 |
|---|---|
| Melting Point | 125-128ºC |
| Molecular Formula | C22H27N9O7S2 |
| Molecular Weight | 593.63600 |
| Exact Mass | 593.14700 |
| PSA | 259.65000 |
| LogP | 0.72490 |
| Index of Refraction | 1.744 |
| InChIKey | UIYAXIPXULMHAI-VCLQDNTDSA-N |
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)OCOC(=O)C(C)(C)C)=C(Cn3nnc(C)n3)CSC12)c1csc(N)n1 |
| Storage condition | Hygroscopic, -20°C Freezer, Under Inert Atmosphere |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| Antibiotic T 2588 |
| [(2,2-Dimethylpropanoyl)oxy]methyl (6R,7R)-7-{[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3-[(5-methyl-2H-tetrazol-2-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| Cefteram pivaloyloxymethyl ester |
| Ro 19-5248 |
| Tomiron 100 |
| 5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 7-[[(2E)-2-(2-amino-4-thiazolyl)-2-(methoxyimino)-1-oxoethyl]amino]-3-[(5-methyl-2H-tetrazol-2-yl)methyl]-8-oxo-, (2,2-dimethyl-1-oxopropoxy)methyl ester, (6R,7R)- |
| CefteramPivoxilCefteramPivoxil |
| cefteram pivoxil |
| Tomiron |
| CEFTERAMPIVOXYL |
| T 2588 |