4(1H)-Pyrimidinone, 5-[(2-hydroxyethylthio]-6-methyl-2-(trichloromethyl)-
Modify Date: 2025-10-15 14:18:57
![4(1H)-Pyrimidinone, 5-[(2-hydroxyethylthio]-6-methyl-2-(trichloromethyl)- Structure](https://image.chemsrc.com/caspic/484/82551-97-1.png)
4(1H)-Pyrimidinone, 5-[(2-hydroxyethylthio]-6-methyl-2-(trichloromethyl)- structure
|
Common Name | 4(1H)-Pyrimidinone, 5-[(2-hydroxyethylthio]-6-methyl-2-(trichloromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 82551-97-1 | Molecular Weight | 303.59300 | |
| Density | 1.65g/cm3 | Boiling Point | 369.2ºC at 760 mmHg | |
| Molecular Formula | C8H9Cl3N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.1ºC | |
| Name | 5-(2-hydroxyethylsulfanyl)-6-methyl-2-(trichloromethyl)-1H-pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.65g/cm3 |
|---|---|
| Boiling Point | 369.2ºC at 760 mmHg |
| Molecular Formula | C8H9Cl3N2O2S |
| Molecular Weight | 303.59300 |
| Flash Point | 177.1ºC |
| Exact Mass | 301.94500 |
| PSA | 91.28000 |
| LogP | 1.98940 |
| Index of Refraction | 1.644 |
| InChIKey | LRBZAAPEYSGAJK-UHFFFAOYSA-N |
| SMILES | Cc1nc(C(Cl)(Cl)Cl)[nH]c(=O)c1SCCO |
|
~57%
4(1H)-Pyrimidin... CAS#:82551-97-1 |
| Literature: Kulka, Marshall; Harrison, W. A. Canadian Journal of Chemistry, 1982 , vol. 60, p. 1101 - 1105 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| CCG-2595 |
| 5-[(2-hydroxyethyl)thio]-6-methyl-2-(trichloromethyl)-4(1H)-pyrimidinone |
| 5-[(2-hydroxyethyl)thio]-6-methyl-2-(trichloromethyl)-1,4-dihydropyrimidin-4-one |