2-phenyl-7-propan-2-yloxy-1H-quinolin-4-one structure
|
Common Name | 2-phenyl-7-propan-2-yloxy-1H-quinolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 825620-18-6 | Molecular Weight | 279.33300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-phenyl-7-propan-2-yloxy-1H-quinolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H17NO2 |
|---|---|
| Molecular Weight | 279.33300 |
| Exact Mass | 279.12600 |
| PSA | 42.09000 |
| LogP | 3.98230 |
| InChIKey | WWJSSYQFNXTUMI-UHFFFAOYSA-N |
| SMILES | CC(C)Oc1ccc2c(=O)cc(-c3ccccc3)[nH]c2c1 |
|
~%
2-phenyl-7-prop... CAS#:825620-18-6 |
| Literature: Llinas-Brunet, Montse; Bailey, Murray D.; Ghiro, Elise; Gorys, Vida; Halmos, Ted; Poirier, Martin; Rancourt, Jean; Goudreau, Nathalie Journal of Medicinal Chemistry, 2004 , vol. 47, # 26 p. 6584 - 6594 |
|
~%
2-phenyl-7-prop... CAS#:825620-18-6 |
| Literature: Llinas-Brunet, Montse; Bailey, Murray D.; Ghiro, Elise; Gorys, Vida; Halmos, Ted; Poirier, Martin; Rancourt, Jean; Goudreau, Nathalie Journal of Medicinal Chemistry, 2004 , vol. 47, # 26 p. 6584 - 6594 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Quinolinol,7-(1-methylethoxy)-2-phenyl |
| 7-isopropoxy-2-phenylquinolin-4-ol |