ethyl 6-(4-tert-butylphenyl)-1H-indole-2-carboxylate
ethyl 6-(4-tert-butylphenyl)-1H-indole-2-carboxylate structure
|
Common Name | ethyl 6-(4-tert-butylphenyl)-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 825623-16-3 | Molecular Weight | 321.41300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 6-(4-tert-butylphenyl)-1H-indole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H23NO2 |
|---|---|
| Molecular Weight | 321.41300 |
| Exact Mass | 321.17300 |
| PSA | 42.09000 |
| LogP | 5.30910 |
| InChIKey | JDDRSQCGAJLGRO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2ccc(-c3ccc(C(C)(C)C)cc3)cc2[nH]1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~81%
ethyl 6-(4-tert... CAS#:825623-16-3 |
| Literature: BIOLIPOX AB; MCNEENEY, Stephen, Phillip Patent: WO2005/5415 A1, 2005 ; Location in patent: Page/Page column 51 ; WO 2005/005415 A1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1H-Indole-2-carboxylic acid,6-[4-(1,1-dimethylethyl)phenyl]-,ethyl ester |
| 6-(4-tert-butylphenyl)indole-2-carboxylic acid ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of ethyl 6-(4-tert-butylphenyl)-1H-indole-2-carboxylate? |
| A: LogP of ethyl 6-(4-tert-butylphenyl)-1H-indole-2-carboxylate is 5.30910. |
| Q: What is the SMILES notation of ethyl 6-(4-tert-butylphenyl)-1H-indole-2-carboxylate? |
| A: SMILES notation of ethyl 6-(4-tert-butylphenyl)-1H-indole-2-carboxylate is CCOC(=O)c1cc2ccc(-c3ccc(C(C)(C)C)cc3)cc2[nH]1. |
| Q: What is the molecular formula of ethyl 6-(4-tert-butylphenyl)-1H-indole-2-carboxylate? |
| A: Molecular formula of ethyl 6-(4-tert-butylphenyl)-1H-indole-2-carboxylate is C21H23NO2. |
| Q: What is the English name of ethyl 6-(4-tert-butylphenyl)-1H-indole-2-carboxylate? |
| A: The English name of ethyl 6-(4-tert-butylphenyl)-1H-indole-2-carboxylate is ethyl 6-(4-tert-butylphenyl)-1H-indole-2-carboxylate. |
| Q: What is the molecular weight of ethyl 6-(4-tert-butylphenyl)-1H-indole-2-carboxylate? |
| A: Molecular weight of ethyl 6-(4-tert-butylphenyl)-1H-indole-2-carboxylate is 321.41300. |
| Q: What English synonyms does ethyl 6-(4-tert-butylphenyl)-1H-indole-2-carboxylate have? |
| A: English synonyms of ethyl 6-(4-tert-butylphenyl)-1H-indole-2-carboxylate: 1H-Indole-2-carboxylic acid,6-[4-(1,1-dimethylethyl)phenyl]-,ethyl ester, 6-(4-tert-butylphenyl)indole-2-carboxylic acid ethyl ester. |
| Q: What is the CAS number of ethyl 6-(4-tert-butylphenyl)-1H-indole-2-carboxylate? |
| A: CAS number of ethyl 6-(4-tert-butylphenyl)-1H-indole-2-carboxylate is 825623-16-3. |
| Q: What is the InChIKey of ethyl 6-(4-tert-butylphenyl)-1H-indole-2-carboxylate? |
| A: InChIKey of ethyl 6-(4-tert-butylphenyl)-1H-indole-2-carboxylate is JDDRSQCGAJLGRO-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of ethyl 6-(4-tert-butylphenyl)-1H-indole-2-carboxylate? |
| A: Polar surface area (PSA) of ethyl 6-(4-tert-butylphenyl)-1H-indole-2-carboxylate is 42.09000. |
| Q: What is the Chinese name of 825623-16-3? |
| A: Chinese name of 825623-16-3 is 825623-16-3. |