trimethyl-[prop-1-ynyl-bis(trimethylsilyl)silyl]silane structure
|
Common Name | trimethyl-[prop-1-ynyl-bis(trimethylsilyl)silyl]silane | ||
|---|---|---|---|---|
| CAS Number | 825626-48-0 | Molecular Weight | 286.70900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H30Si4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-[prop-1-ynyl-bis(trimethylsilyl)silyl]silane |
|---|
| Molecular Formula | C12H30Si4 |
|---|---|
| Molecular Weight | 286.70900 |
| Exact Mass | 286.14200 |
| LogP | 4.24750 |
| InChIKey | ZLPQCORJLVCDRB-UHFFFAOYSA-N |
| SMILES | CC#C[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
|
~76%
trimethyl-[prop... CAS#:825626-48-0 |
| Literature: Mechtler, Christian; Zirngast, Michaela; Baumgartner, Judith; Marschner, Christoph European Journal of Inorganic Chemistry, 2004 , # 16 p. 3254 - 3261 |
|
~%
trimethyl-[prop... CAS#:825626-48-0 |
| Literature: Mechtler, Christian; Zirngast, Michaela; Baumgartner, Judith; Marschner, Christoph European Journal of Inorganic Chemistry, 2004 , # 16 p. 3254 - 3261 |