gold,triphenyl(2-pyridin-4-ylethynyl)phosphanium
gold,triphenyl(2-pyridin-4-ylethynyl)phosphanium structure
|
Common Name | gold,triphenyl(2-pyridin-4-ylethynyl)phosphanium | ||
|---|---|---|---|---|
| CAS Number | 825628-22-6 | Molecular Weight | 561.36500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H19AuNP+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | gold,triphenyl(2-pyridin-4-ylethynyl)phosphanium |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H19AuNP+ |
|---|---|
| Molecular Weight | 561.36500 |
| Exact Mass | 561.09200 |
| PSA | 26.48000 |
| LogP | 4.38220 |
| InChIKey | GQIPQPBRGHVNOA-UHFFFAOYSA-N |
| SMILES | C(#C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccncc1.[Au] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~70%
gold,triphenyl(... CAS#:825628-22-6 |
| Literature: Cheung, Kai-Leung; Yip, Sung-Kong; Yam, Vivian Wing-Wah Journal of Organometallic Chemistry, 2004 , vol. 689, # 24 SPEC. ISS. p. 4451 - 4462 |
|
~85%
gold,triphenyl(... CAS#:825628-22-6 |
| Literature: Ferrer, Montserrat; Gutierrez, Albert; Rodriguez, Laura; Rossell, Oriol; Lima, Joao C.; Font-Bardia, Merce; Solans, Xavier European Journal of Inorganic Chemistry, 2008 , # 18 p. 2899 - 2909 |
![[Au(CC-C5H4N)]n structure](https://image.chemsrc.com/caspic/088/854053-14-8.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Gold,(4-pyridinylethynyl)(triphenylphosphine) |
| ((4-pyridyl)ethylnyl)(triphenylphosphine)gold(I) |
| [(PPh3)Au(CCC5H4N)] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does gold,triphenyl(2-pyridin-4-ylethynyl)phosphanium have? |
| A: English synonyms of gold,triphenyl(2-pyridin-4-ylethynyl)phosphanium: Gold,(4-pyridinylethynyl)(triphenylphosphine), ((4-pyridyl)ethylnyl)(triphenylphosphine)gold(I), [(PPh3)Au(CCC5H4N)]. |
| Q: What is the molecular weight of gold,triphenyl(2-pyridin-4-ylethynyl)phosphanium? |
| A: Molecular weight of gold,triphenyl(2-pyridin-4-ylethynyl)phosphanium is 561.36500. |
| Q: What are the upstream materials of gold,triphenyl(2-pyridin-4-ylethynyl)phosphanium? |
| A: Related upstream materials(CAS) of gold,triphenyl(2-pyridin-4-ylethynyl)phosphanium: 2510-22-7;14243-64-2;854053-14-8;603-35-0. |
| Q: What is the InChIKey of gold,triphenyl(2-pyridin-4-ylethynyl)phosphanium? |
| A: InChIKey of gold,triphenyl(2-pyridin-4-ylethynyl)phosphanium is GQIPQPBRGHVNOA-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of gold,triphenyl(2-pyridin-4-ylethynyl)phosphanium? |
| A: SMILES notation of gold,triphenyl(2-pyridin-4-ylethynyl)phosphanium is C(#C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccncc1.[Au]. |
| Q: What is the English name of gold,triphenyl(2-pyridin-4-ylethynyl)phosphanium? |
| A: The English name of gold,triphenyl(2-pyridin-4-ylethynyl)phosphanium is gold,triphenyl(2-pyridin-4-ylethynyl)phosphanium. |
| Q: What is the polar surface area (PSA) of gold,triphenyl(2-pyridin-4-ylethynyl)phosphanium? |
| A: Polar surface area (PSA) of gold,triphenyl(2-pyridin-4-ylethynyl)phosphanium is 26.48000. |
| Q: What is the LogP of gold,triphenyl(2-pyridin-4-ylethynyl)phosphanium? |
| A: LogP of gold,triphenyl(2-pyridin-4-ylethynyl)phosphanium is 4.38220. |
| Q: What is the Chinese name of 825628-22-6? |
| A: Chinese name of 825628-22-6 is 825628-22-6. |
| Q: What is the CAS number of gold,triphenyl(2-pyridin-4-ylethynyl)phosphanium? |
| A: CAS number of gold,triphenyl(2-pyridin-4-ylethynyl)phosphanium is 825628-22-6. |