1-(3,4-Dichlorophenyl)-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethan-1-one structure
|
Common Name | 1-(3,4-Dichlorophenyl)-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethan-1-one | ||
|---|---|---|---|---|
| CAS Number | 825656-56-2 | Molecular Weight | 365.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H10Cl2N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3,4-Dichlorophenyl)-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethan-1-one |
|---|
| Molecular Formula | C16H10Cl2N2O2S |
|---|---|
| Molecular Weight | 365.2 |
| InChIKey | NDHQYCFZNSJEPL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(O2)SCC(=O)C3=CC(=C(C=C3)Cl)Cl |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Inhibition of alpha-glucosidase (unknown origin) using p-nitrophenyl-alpha-D-glucopyr...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3373798
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_MPD
|