2-Methyl-4-morpholinoquinoline structure
|
Common Name | 2-Methyl-4-morpholinoquinoline | ||
|---|---|---|---|---|
| CAS Number | 82607-87-2 | Molecular Weight | 228.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Methyl-4-morpholinoquinoline |
|---|
| Molecular Formula | C14H16N2O |
|---|---|
| Molecular Weight | 228.29 |
| InChIKey | MVHYZDDSGBXCEZ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC=CC=C2C(=C1)N3CCOCC3 |
|
Name: Covalent inhibition of recombinant human His-tagged p47phox SH3A-B domain (151 to 285...
Source: ChEMBL
Target: Neutrophil cytosol factor 1
External Id: CHEMBL4381025
|
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Binding affinity to immobilized recombinant human His-tagged p47phox SH3A-B domain (1...
Source: ChEMBL
Target: Neutrophil cytosol factor 1
External Id: CHEMBL4381033
|