2,3,6,7,10,11-Hexabromotriphenylene structure
|
Common Name | 2,3,6,7,10,11-Hexabromotriphenylene | ||
|---|---|---|---|---|
| CAS Number | 82632-80-2 | Molecular Weight | 701.664 | |
| Density | 2.4±0.1 g/cm3 | Boiling Point | 689.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H6Br6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 354.3±24.8 °C | |
| Name | 2,3,6,7,10,11-Hexabromotriphenylene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 689.8±50.0 °C at 760 mmHg |
| Molecular Formula | C18H6Br6 |
| Molecular Weight | 701.664 |
| Flash Point | 354.3±24.8 °C |
| Exact Mass | 695.556946 |
| LogP | 10.14 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.822 |
| InChIKey | GLHQUXLCQLQNPZ-UHFFFAOYSA-N |
| SMILES | Brc1cc2c3cc(Br)c(Br)cc3c3cc(Br)c(Br)cc3c2cc1Br |
| HS Code | 2903999090 |
|---|
|
~92%
2,3,6,7,10,11-H... CAS#:82632-80-2 |
| Literature: Yatabe, Tetsuo; Harbison, Martha A.; Brand, Johann Diedrich; Wagner, Manfred; Muellen, Klaus; Samori, Paolo; Rabe, Juergen P. Journal of Materials Chemistry, 2000 , vol. 10, # 7 p. 1519 - 1525 |
|
~%
2,3,6,7,10,11-H... CAS#:82632-80-2 |
| Literature: Journal of the American Chemical Society, , vol. 131, p. 7287 - 7292 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Triphenylene, 2,3,6,7,10,11-hexabromo- |
| 2,3,6,7,10,11-Hexabromtriphenylen |
| 2,3,6,7,10,11-Hexabromotriphenylene |
| 2,3,6,7,10,11-hexabromo-triphenylene |
| hexabromotriphenylene |