bis(2,2-dimethyl-3-azabicyclo[2.2.2]octan-3-yl)diazene structure
|
Common Name | bis(2,2-dimethyl-3-azabicyclo[2.2.2]octan-3-yl)diazene | ||
|---|---|---|---|---|
| CAS Number | 82666-10-2 | Molecular Weight | 304.47300 | |
| Density | 1.23g/cm3 | Boiling Point | 375.8ºC at 760 mmHg | |
| Molecular Formula | C18H32N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.1ºC | |
| Name | bis(2,2-dimethyl-3-azabicyclo[2.2.2]octan-3-yl)diazene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 375.8ºC at 760 mmHg |
| Molecular Formula | C18H32N4 |
| Molecular Weight | 304.47300 |
| Flash Point | 181.1ºC |
| Exact Mass | 304.26300 |
| PSA | 31.20000 |
| LogP | 4.45040 |
| Index of Refraction | 1.647 |
| InChIKey | NYDWYOCTHAOZTP-UHFFFAOYSA-N |
| SMILES | CC1(C)C2CCC(CC2)N1N=NN1C2CCC(CC2)C1(C)C |
|
~92%
bis(2,2-dimethy... CAS#:82666-10-2 |
| Literature: Nelsen,S.F.; Gannett,P.M. Journal of the American Chemical Society, 1982 , vol. 104, p. 5292 |
|
~%
bis(2,2-dimethy... CAS#:82666-10-2 |
| Literature: Nelsen,S.F.; Gannett,P.M. Journal of the American Chemical Society, 1982 , vol. 104, p. 5292 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| BIS(8,8-DIMETHYL-7-AZABICYCLO[2.2.2]OCT-7-YL)DIAZENE |
| azo-2,2'-bis(3,3-dimethyl-2-azabicyclo[2.2.2]octane) |
| Bis(3,3-dimethyl-2-azabicyclo(2.2.2)oct-2-yl)diazene |