2-Pyridinecarboxylic acid, 4-amino-3,5,6-trichloro-, compd. with 2,2,2-nitrilotrisethanol (1:1) structure
|
Common Name | 2-Pyridinecarboxylic acid, 4-amino-3,5,6-trichloro-, compd. with 2,2,2-nitrilotrisethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 82683-78-1 | Molecular Weight | 390.647 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18Cl3N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | picloram-trolamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H18Cl3N3O5 |
|---|---|
| Molecular Weight | 390.647 |
| Exact Mass | 389.031189 |
| InChIKey | KLSSIPFIAURKSX-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)c(Cl)nc(C(=O)O)c1Cl.OCCN(CCO)CCO |
| tris(2-hydroxyethyl)ammonium 4-amino-3,5,6-trichloropicolinate |
| 4-amino-3,5,6-trichloropicolinic acid - 2,2',2"-nitrilotriethanol (1:1) |
| 4-amino-3,5,6-trichloro-2-pyridinecarboxylic acid compound with 2,2',2"-nitrilotris[ethanol] (1:1) |
| picloram-trolamine |
| 4-amino-3,5,6-trichloropyridine-2-carboxylic acid - 2,2',2-nitrilotriethanol (1:1) |
| tris(2-hydroxyethyl)ammonium 4-amino-3,5,6-trichloropyridine-2-carboxylate |
| 4-Amino-3,5,6-trichloro-2-pyridinecarboxylic acid - 2,2',2''-nitrilotriethanol (1:1) |
| 2-Pyridinecarboxylic acid, 4-amino-3,5,6-trichloro-, compd. with 2,2',2''-nitrilotris[ethanol] (1:1) |