dichloro-(4-nitrophenyl)-λ3-iodane
dichloro-(4-nitrophenyl)-λ3-iodane structure
|
Common Name | dichloro-(4-nitrophenyl)-λ3-iodane | ||
|---|---|---|---|---|
| CAS Number | 827-98-5 | Molecular Weight | 319.91200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H4Cl2INO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dichloro-(4-nitrophenyl)-λ3-iodane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H4Cl2INO2 |
|---|---|
| Molecular Weight | 319.91200 |
| Exact Mass | 318.86600 |
| PSA | 45.82000 |
| LogP | 4.10160 |
| InChIKey | IVGLMEYUZDHEBY-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(I(Cl)Cl)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~97%
dichloro-(4-nit... CAS#:827-98-5 |
| Literature: Zhao, Xue-Fei; Zhang, Chi Synthesis, 2007 , # 4 p. 551 - 557 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 3 | |
CAS#:69003-40-3
CAS#:7782-50-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| p-nitrophenyliodide dichloride |
| p-nitroiodobenzene dichloride |
| 4-Nitro-1-iodbenzol-dichlorid |
| 4-nitro(dichloroiodo)benzene |
| dichloro-(4-nitrophenyl) |
| 1-Dichlorjodanyl-4-nitro-benzol |
| 1-dichloroiodanyl-4-nitro-benzene |
| 4-(dichloroiodo)-nitro-benzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does dichloro-(4-nitrophenyl)-λ3-iodane have? |
| A: English synonyms of dichloro-(4-nitrophenyl)-λ3-iodane: p-nitrophenyliodide dichloride, p-nitroiodobenzene dichloride, 4-Nitro-1-iodbenzol-dichlorid, 4-nitro(dichloroiodo)benzene, dichloro-(4-nitrophenyl), 1-Dichlorjodanyl-4-nitro-benzol, 1-dichloroiodanyl-4-nitro-benzene, 4-(dichloroiodo)-nitro-benzene. |
| Q: What is the SMILES notation of dichloro-(4-nitrophenyl)-λ3-iodane? |
| A: SMILES notation of dichloro-(4-nitrophenyl)-λ3-iodane is O=[N+]([O-])c1ccc(I(Cl)Cl)cc1. |
| Q: What are the upstream materials of dichloro-(4-nitrophenyl)-λ3-iodane? |
| A: Related upstream materials(CAS) of dichloro-(4-nitrophenyl)-λ3-iodane: 636-98-6. |
| Q: What is the Chinese name of 827-98-5? |
| A: Chinese name of 827-98-5 is 827-98-5. |
| Q: What is the CAS number of dichloro-(4-nitrophenyl)-λ3-iodane? |
| A: CAS number of dichloro-(4-nitrophenyl)-λ3-iodane is 827-98-5. |
| Q: What is the InChIKey of dichloro-(4-nitrophenyl)-λ3-iodane? |
| A: InChIKey of dichloro-(4-nitrophenyl)-λ3-iodane is IVGLMEYUZDHEBY-UHFFFAOYSA-N. |
| Q: What is the LogP of dichloro-(4-nitrophenyl)-λ3-iodane? |
| A: LogP of dichloro-(4-nitrophenyl)-λ3-iodane is 4.10160. |
| Q: What is the molecular weight of dichloro-(4-nitrophenyl)-λ3-iodane? |
| A: Molecular weight of dichloro-(4-nitrophenyl)-λ3-iodane is 319.91200. |
| Q: What are the downstream products of dichloro-(4-nitrophenyl)-λ3-iodane? |
| A: Related downstream products(CAS) of dichloro-(4-nitrophenyl)-λ3-iodane: 636-98-6;69003-40-3;7782-50-5. |
| Q: What is the English name of dichloro-(4-nitrophenyl)-λ3-iodane? |
| A: The English name of dichloro-(4-nitrophenyl)-λ3-iodane is dichloro-(4-nitrophenyl)-λ3-iodane. |