GSK984 structure
|
Common Name | GSK984 | ||
|---|---|---|---|---|
| CAS Number | 827591-04-8 | Molecular Weight | 325.792 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 627.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C18H16ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 333.1±31.5 °C | |
Use of GSK984GSK984 is a negative control probe for GSK983 (GLXC-08449). |
| Name | GSK984 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 627.1±55.0 °C at 760 mmHg |
| Molecular Formula | C18H16ClN3O |
| Molecular Weight | 325.792 |
| Flash Point | 333.1±31.5 °C |
| Exact Mass | 325.098175 |
| LogP | 3.28 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.695 |
| InChIKey | WJQBOBGVBBZLJU-HNNXBMFYSA-N |
| SMILES | O=C(NC1CCCc2c1[nH]c1ccc(Cl)cc21)c1ccccn1 |
| N-[(1S)-6-Chloro-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-2-pyridinecarboxamide |
| GSK984 |
| 2-Pyridinecarboxamide, N-[(1S)-6-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-yl]- |