AKOS B029363
Modify Date: 2025-09-06 06:00:39
AKOS B029363 structure
|
Common Name | AKOS B029363 | ||
|---|---|---|---|---|
| CAS Number | 827593-20-4 | Molecular Weight | 228.67200 | |
| Density | 1.176g/cm3 | Boiling Point | 319.73ºC at 760 mmHg | |
| Molecular Formula | C11H13ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.608ºC | |
| Name | 5-chloro-3-methoxy-2-propan-2-yloxybenzaldehyde |
|---|
| Density | 1.176g/cm3 |
|---|---|
| Boiling Point | 319.73ºC at 760 mmHg |
| Molecular Formula | C11H13ClO3 |
| Molecular Weight | 228.67200 |
| Flash Point | 129.608ºC |
| Exact Mass | 228.05500 |
| PSA | 35.53000 |
| LogP | 2.94830 |
| Index of Refraction | 1.534 |
| InChIKey | ZWOOAUXTBHPQPI-UHFFFAOYSA-N |
| SMILES | COc1cc(Cl)cc(C=O)c1OC(C)C |
| HS Code | 2913000090 |
|---|
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |