(3,5-dihydroxyphenyl) 4-azidobenzoate structure
|
Common Name | (3,5-dihydroxyphenyl) 4-azidobenzoate | ||
|---|---|---|---|---|
| CAS Number | 827623-39-2 | Molecular Weight | 271.22800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3,5-dihydroxyphenyl) 4-azidobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H9N3O4 |
|---|---|
| Molecular Weight | 271.22800 |
| Exact Mass | 271.05900 |
| PSA | 116.51000 |
| LogP | 2.71156 |
| InChIKey | QIYITBDCKATNQY-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=Nc1ccc(C(=O)Oc2cc(O)cc(O)c2)cc1 |
|
~78%
(3,5-dihydroxyp... CAS#:827623-39-2 |
| Literature: THE SECRETARY OF STATE FOR DEFENCE Patent: WO2005/28423 A2, 2005 ; Location in patent: Page/Page column 28 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzoic acid,4-azido-,3,5-dihydroxyphenyl ester |
| 3,5-dihydroxyphenyl 4-azidobenzoate |