3,7-dimethyl-6-octenyl 3,7-dimethyloct-6-enoate structure
|
Common Name | 3,7-dimethyl-6-octenyl 3,7-dimethyloct-6-enoate | ||
|---|---|---|---|---|
| CAS Number | 82766-40-3 | Molecular Weight | 308.49900 | |
| Density | 0.882g/cm3 | Boiling Point | 386.6ºC at 760 mmHg | |
| Molecular Formula | C20H36O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95.3ºC | |
| Name | 3,7-dimethyloct-6-enyl 3,7-dimethyloct-6-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.882g/cm3 |
|---|---|
| Boiling Point | 386.6ºC at 760 mmHg |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.49900 |
| Flash Point | 95.3ºC |
| Exact Mass | 308.27200 |
| PSA | 26.30000 |
| LogP | 6.07480 |
| Index of Refraction | 1.462 |
| InChIKey | HUZXZYWMBWQTNX-UHFFFAOYSA-N |
| SMILES | CC(C)=CCCC(C)CCOC(=O)CC(C)CCC=C(C)C |
| HS Code | 2916190090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 3,7-Dimethyl-6-octenyl 3,7-dimethyloct-6-enoate |
| Citronellylcitronellate |
| citronellic acid citronellylester |
| 6-Octenoic acid,3,7-dimethyl-,3,7-dimethyl-6-octen-1-yl ester |
| EINECS 280-025-3 |