benzyl 3-(dibenzylamino)-2-fluoro-4-methyl-pentanoate structure
|
Common Name | benzyl 3-(dibenzylamino)-2-fluoro-4-methyl-pentanoate | ||
|---|---|---|---|---|
| CAS Number | 82770-48-7 | Molecular Weight | 419.53100 | |
| Density | 1.114g/cm3 | Boiling Point | 514.8ºC at 760 mmHg | |
| Molecular Formula | C27H30FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.1ºC | |
| Name | benzyl 3-(dibenzylamino)-2-fluoro-4-methylpentanoate |
|---|
| Density | 1.114g/cm3 |
|---|---|
| Boiling Point | 514.8ºC at 760 mmHg |
| Molecular Formula | C27H30FNO2 |
| Molecular Weight | 419.53100 |
| Flash Point | 265.1ºC |
| Exact Mass | 419.22600 |
| PSA | 29.54000 |
| LogP | 5.79490 |
| Index of Refraction | 1.565 |
| InChIKey | DSSFNGQBDOOLFJ-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(F)C(=O)OCc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
|
~92%
benzyl 3-(diben... CAS#:82770-48-7 |
| Literature: Somekh, Lila; Shanzer, Abraham Journal of the American Chemical Society, 1982 , vol. 104, # 21 p. 5836 - 5837 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |