1-(1,2,3,4-Tetrahydroisoquinolin-7-yl)ethanone hydrochloride structure
|
Common Name | 1-(1,2,3,4-Tetrahydroisoquinolin-7-yl)ethanone hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 82771-27-5 | Molecular Weight | 151.206 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 293.0±20.0 °C at 760 mmHg | |
| Molecular Formula | C9H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.0±21.8 °C | |
| Name | 1-(1,2,3,4-Tetrahydroisoquinolin-7-yl)ethanone hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 293.0±20.0 °C at 760 mmHg |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.206 |
| Flash Point | 131.0±21.8 °C |
| Exact Mass | 151.099716 |
| PSA | 29.10000 |
| LogP | 0.59 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | XXKMOPZYIXRHNB-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc2c(c1)CNCC2.Cl |
| HS Code | 2933499090 |
|---|
|
~81%
1-(1,2,3,4-Tetr... CAS#:82771-27-5 |
| Literature: Ali; Gleason; Hill; Krell; Kruse; Lavanchy; Volpe Journal of Medicinal Chemistry, 1982 , vol. 25, # 10 p. 1235 - 1240 |
|
~%
1-(1,2,3,4-Tetr... CAS#:82771-27-5 |
| Literature: Ali; Gleason; Hill; Krell; Kruse; Lavanchy; Volpe Journal of Medicinal Chemistry, 1982 , vol. 25, # 10 p. 1235 - 1240 |
|
~%
1-(1,2,3,4-Tetr... CAS#:82771-27-5 |
| Literature: Ali; Gleason; Hill; Krell; Kruse; Lavanchy; Volpe Journal of Medicinal Chemistry, 1982 , vol. 25, # 10 p. 1235 - 1240 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzenepropanol, γ-amino-, (γS)- |
| 1-(1,2,3,4-tetrahydroisoquinolin-7-yl)ethanone,hydrochloride |
| (3S)-3-Amino-3-phenyl-1-propanol |
| (3S)-3-Amino-3-phenylpropan-1-ol |
| 3-Amino-3-phenyl-1-propanol |
| 3-Amino-3-phenyl-propan-1-ol |
| Benzenepropanol, γ-amino- |
| 3-amino-3-phenylpropan-1-ol |