1H-Pyrido[3,4-b]indole-3-carboxylicacid, 2,3,4,9-tetrahydro-1-phenyl- structure
|
Common Name | 1H-Pyrido[3,4-b]indole-3-carboxylicacid, 2,3,4,9-tetrahydro-1-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 82789-18-2 | Molecular Weight | 292.33200 | |
| Density | 1.321g/cm3 | Boiling Point | 553.5ºC at 760mmHg | |
| Molecular Formula | C18H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.6ºC | |
| Name | 1-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.321g/cm3 |
|---|---|
| Boiling Point | 553.5ºC at 760mmHg |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.33200 |
| Flash Point | 288.6ºC |
| Exact Mass | 292.12100 |
| PSA | 65.12000 |
| LogP | 3.18500 |
| Index of Refraction | 1.69 |
| InChIKey | ZJSUEWDIHUPPRO-UHFFFAOYSA-N |
| SMILES | O=C(O)C1Cc2c([nH]c3ccccc23)C(c2ccccc2)N1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-phenyl-1,2,3,4-tetrahydronorharman-3-carboxylic acid |
| 1-phenyl-1,2,3,4-tetrahydrobeta-carboline-3-carboxylic acid |