1H-Indazol-3-amine, N-(3-(4-methyl-1-piperazinyl)propyl)- structure
|
Common Name | 1H-Indazol-3-amine, N-(3-(4-methyl-1-piperazinyl)propyl)- | ||
|---|---|---|---|---|
| CAS Number | 82819-18-9 | Molecular Weight | 273.37700 | |
| Density | 1.177g/cm3 | Boiling Point | 488.7ºC at 760 mmHg | |
| Molecular Formula | C15H23N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.4ºC | |
| Name | N-[3-(4-methylpiperazin-1-yl)propyl]-1H-indazol-3-amine |
|---|
| Density | 1.177g/cm3 |
|---|---|
| Boiling Point | 488.7ºC at 760 mmHg |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.37700 |
| Flash Point | 249.4ºC |
| Exact Mass | 273.19500 |
| PSA | 50.42000 |
| LogP | 0.91000 |
| Index of Refraction | 1.641 |
| InChIKey | SKAMGHNAFBARFP-UHFFFAOYSA-N |
| SMILES | CN1CCN(CCCNc2n[nH]c3ccccc23)CC1 |
| HS Code | 2933990090 |
|---|
|
~58%
1H-Indazol-3-am... CAS#:82819-18-9 |
| Literature: Kawakubo; Fukuzaki; Sone Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 6 p. 2292 - 2299 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |