POLY-L-THREONINE structure
|
Common Name | POLY-L-THREONINE | ||
|---|---|---|---|---|
| CAS Number | 82822-12-6 | Molecular Weight | 218.212 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 457.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C10H10N4O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 230.5±31.5 °C | |
| Name | (5-p-Tolyl-tetrazol-2-yl)-acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 457.5±55.0 °C at 760 mmHg |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.212 |
| Flash Point | 230.5±31.5 °C |
| Exact Mass | 218.080383 |
| LogP | 1.50 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.673 |
| InChIKey | QBJSWVLDHWIJDK-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2nnn(CC(=O)O)n2)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
|
Interactions between homopolypeptides and lightly cross-linked microgels.
Langmuir 25 , 522-528, (2009) The relative importance of electrostatic and nonelectrostatic interactions in peptide-microgel systems was evaluated by micromanipulator-assisted light microscopy, confocal microscopy, and circular di... |
| 2H-Tetrazole-2-acetic acid, 5-(4-methylphenyl)- |
| [5-(4-Methylphenyl)-2H-tetrazol-2-yl]acetic acid |
| (5-p-Tolyl-tetrazol-2-yl)-acetic acid |
| 2-[5-(4-methylphenyl)-2H-1,2,3,4-tetraazol-2-yl]acetic acid |