Phosphorodithioic acid, O,O-bis(1-methylethyl) S-[2-[(phenylsulfonyl)amino]ethyl] ester mixt. with 3-[2,4-dichloro-5-(1-methylethoxy)phenyl]-5-(1,1-dimethylethyl)-1,3,4-oxadiazol-2(3H)-one structure
|
Common Name | Phosphorodithioic acid, O,O-bis(1-methylethyl) S-[2-[(phenylsulfonyl)amino]ethyl] ester mixt. with 3-[2,4-dichloro-5-(1-methylethoxy)phenyl]-5-(1,1-dimethylethyl)-1,3,4-oxadiazol-2(3H)-one | ||
|---|---|---|---|---|
| CAS Number | 82824-95-1 | Molecular Weight | 742.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H42Cl2N3O7PS3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Phosphorodithioic acid, O,O-bis(1-methylethyl) S-[2-[(phenylsulfonyl)amino]ethyl] ester mixt. with 3-[2,4-dichloro-5-(1-methylethoxy)phenyl]-5-(1,1-dimethylethyl)-1,3,4-oxadiazol-2(3H)-one |
|---|
| Molecular Formula | C29H42Cl2N3O7PS3 |
|---|---|
| Molecular Weight | 742.7 |
| InChIKey | IBZNVNMPQFZFIT-UHFFFAOYSA-N |
| SMILES | CC(C)OP(=S)(OC(C)C)SCCNS(=O)(=O)c1ccccc1.CC(C)Oc1cc(-n2nc(C(C)(C)C)oc2=O)c(Cl)cc1Cl |