C-(1-Methyl-5-trifluoromethyl-1H-benzoimidazol-2-yl)-methylamine
Modify Date: 2025-09-13 20:17:22
C-(1-Methyl-5-trifluoromethyl-1H-benzoimidazol-2-yl)-methylamine structure
|
Common Name | C-(1-Methyl-5-trifluoromethyl-1H-benzoimidazol-2-yl)-methylamine | ||
|---|---|---|---|---|
| CAS Number | 828241-99-2 | Molecular Weight | 229.20200 | |
| Density | 1.414g/cm3 | Boiling Point | 335.32ºC at 760 mmHg | |
| Molecular Formula | C10H10F3N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.596ºC | |
| Name | [1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]methanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.414g/cm3 |
|---|---|
| Boiling Point | 335.32ºC at 760 mmHg |
| Molecular Formula | C10H10F3N3 |
| Molecular Weight | 229.20200 |
| Flash Point | 156.596ºC |
| Exact Mass | 229.08300 |
| PSA | 43.84000 |
| LogP | 2.75110 |
| Index of Refraction | 1.56 |
| InChIKey | IDMFQDHIVDCRQN-UHFFFAOYSA-N |
| SMILES | Cn1c(CN)nc2cc(C(F)(F)F)ccc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| [1-methyl-5-(trifluoromethyl)-1H-benzimidazol-2-yl]methylamine |
| 1-[1-methyl-5-(trifluoromethyl)-1H-benzimidazol-2-yl]methanamine |
| C-(1-Methyl-5-trifluoromethyl-1H-benzoimidazol-2-yl)-methylamine |
| [1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]methylamine |