4-(chloromethyl)-7-phenylmethoxychromen-2-one structure
|
Common Name | 4-(chloromethyl)-7-phenylmethoxychromen-2-one | ||
|---|---|---|---|---|
| CAS Number | 828265-69-6 | Molecular Weight | 300.73600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H13ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(chloromethyl)-7-phenylmethoxychromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H13ClO3 |
|---|---|
| Molecular Weight | 300.73600 |
| Exact Mass | 300.05500 |
| PSA | 39.44000 |
| LogP | 4.11080 |
| InChIKey | DPKFXKRLUDIOHP-UHFFFAOYSA-N |
| SMILES | O=c1cc(CCl)c2ccc(OCc3ccccc3)cc2o1 |
|
~67%
4-(chloromethyl... CAS#:828265-69-6 |
| Literature: Pisani, Leonardo; Muncipinto, Giovanni; Miscioscia, Teresa Fabiola; Nicolotti, Orazio; Leonetti, Francesco; Catto, Marco; Caccia, Carla; Salvati, Patricia; Soto-Otero, Ramon; Mendez-Alvarez, Estefania; Passeleu, Celine; Carotti, Angelo Journal of Medicinal Chemistry, 2009 , vol. 52, # 21 p. 6685 - 6706 |
|
~%
4-(chloromethyl... CAS#:828265-69-6 |
| Literature: Leonetti, Francesco; Favia, Angelo; Rao, Angela; Aliano, Rosaria; Paluszcak, Anja; Hartmann, Rolf W.; Carotti, Angelo Journal of Medicinal Chemistry, 2004 , vol. 47, # 27 p. 6792 - 6803 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-chloromethyl-7-benzyloxy-2H-chromen-2-one |