4-(chloromethyl)-7-phenylmethoxychromen-2-one
4-(chloromethyl)-7-phenylmethoxychromen-2-one structure
|
Common Name | 4-(chloromethyl)-7-phenylmethoxychromen-2-one | ||
|---|---|---|---|---|
| CAS Number | 828265-69-6 | Molecular Weight | 300.73600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H13ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(chloromethyl)-7-phenylmethoxychromen-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H13ClO3 |
|---|---|
| Molecular Weight | 300.73600 |
| Exact Mass | 300.05500 |
| PSA | 39.44000 |
| LogP | 4.11080 |
| InChIKey | DPKFXKRLUDIOHP-UHFFFAOYSA-N |
| SMILES | O=c1cc(CCl)c2ccc(OCc3ccccc3)cc2o1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~67%
4-(chloromethyl... CAS#:828265-69-6 |
| Literature: Pisani, Leonardo; Muncipinto, Giovanni; Miscioscia, Teresa Fabiola; Nicolotti, Orazio; Leonetti, Francesco; Catto, Marco; Caccia, Carla; Salvati, Patricia; Soto-Otero, Ramon; Mendez-Alvarez, Estefania; Passeleu, Celine; Carotti, Angelo Journal of Medicinal Chemistry, 2009 , vol. 52, # 21 p. 6685 - 6706 |
|
~%
4-(chloromethyl... CAS#:828265-69-6 |
| Literature: Leonetti, Francesco; Favia, Angelo; Rao, Angela; Aliano, Rosaria; Paluszcak, Anja; Hartmann, Rolf W.; Carotti, Angelo Journal of Medicinal Chemistry, 2004 , vol. 47, # 27 p. 6792 - 6803 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-chloromethyl-7-benzyloxy-2H-chromen-2-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-(chloromethyl)-7-phenylmethoxychromen-2-one? |
| A: CAS number of 4-(chloromethyl)-7-phenylmethoxychromen-2-one is 828265-69-6. |
| Q: What is the molecular formula of 4-(chloromethyl)-7-phenylmethoxychromen-2-one? |
| A: Molecular formula of 4-(chloromethyl)-7-phenylmethoxychromen-2-one is C17H13ClO3. |
| Q: What is the molecular weight of 4-(chloromethyl)-7-phenylmethoxychromen-2-one? |
| A: Molecular weight of 4-(chloromethyl)-7-phenylmethoxychromen-2-one is 300.73600. |
| Q: What is the English name of 4-(chloromethyl)-7-phenylmethoxychromen-2-one? |
| A: The English name of 4-(chloromethyl)-7-phenylmethoxychromen-2-one is 4-(chloromethyl)-7-phenylmethoxychromen-2-one. |
| Q: What English synonyms does 4-(chloromethyl)-7-phenylmethoxychromen-2-one have? |
| A: English synonyms of 4-(chloromethyl)-7-phenylmethoxychromen-2-one: 4-chloromethyl-7-benzyloxy-2H-chromen-2-one. |
| Q: What is the LogP of 4-(chloromethyl)-7-phenylmethoxychromen-2-one? |
| A: LogP of 4-(chloromethyl)-7-phenylmethoxychromen-2-one is 4.11080. |
| Q: What is the SMILES notation of 4-(chloromethyl)-7-phenylmethoxychromen-2-one? |
| A: SMILES notation of 4-(chloromethyl)-7-phenylmethoxychromen-2-one is O=c1cc(CCl)c2ccc(OCc3ccccc3)cc2o1. |
| Q: What are the upstream materials of 4-(chloromethyl)-7-phenylmethoxychromen-2-one? |
| A: Related upstream materials(CAS) of 4-(chloromethyl)-7-phenylmethoxychromen-2-one: 25392-41-0;100-39-0;108-46-3. |
| Q: What is the polar surface area (PSA) of 4-(chloromethyl)-7-phenylmethoxychromen-2-one? |
| A: Polar surface area (PSA) of 4-(chloromethyl)-7-phenylmethoxychromen-2-one is 39.44000. |
| Q: What is the Chinese name of 828265-69-6? |
| A: Chinese name of 828265-69-6 is 828265-69-6. |