4-(bromomethyl)-7-phenoxychromen-2-one structure
|
Common Name | 4-(bromomethyl)-7-phenoxychromen-2-one | ||
|---|---|---|---|---|
| CAS Number | 828265-73-2 | Molecular Weight | 331.16100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H11BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(bromomethyl)-7-phenoxychromen-2-one |
|---|
| Molecular Formula | C16H11BrO3 |
|---|---|
| Molecular Weight | 331.16100 |
| Exact Mass | 329.98900 |
| PSA | 39.44000 |
| LogP | 4.48020 |
| InChIKey | BQEWKSWHNHNWEU-UHFFFAOYSA-N |
| SMILES | O=c1cc(CBr)c2ccc(Oc3ccccc3)cc2o1 |
|
~40%
4-(bromomethyl)... CAS#:828265-73-2 |
| Literature: Leonetti, Francesco; Favia, Angelo; Rao, Angela; Aliano, Rosaria; Paluszcak, Anja; Hartmann, Rolf W.; Carotti, Angelo Journal of Medicinal Chemistry, 2004 , vol. 47, # 27 p. 6792 - 6803 |
|
~%
4-(bromomethyl)... CAS#:828265-73-2 |
| Literature: Leonetti, Francesco; Favia, Angelo; Rao, Angela; Aliano, Rosaria; Paluszcak, Anja; Hartmann, Rolf W.; Carotti, Angelo Journal of Medicinal Chemistry, 2004 , vol. 47, # 27 p. 6792 - 6803 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |