N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide
N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide structure
|
Common Name | N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 82845-37-2 | Molecular Weight | 269.34000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H23N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H23N3O3 |
|---|---|
| Molecular Weight | 269.34000 |
| Exact Mass | 269.17400 |
| PSA | 85.49000 |
| LogP | 2.83690 |
| InChIKey | OONMQGITNQTLKI-UHFFFAOYSA-N |
| SMILES | CCC(CC)C(=O)NC(=O)NC(=O)N1CCCCC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~70%
N-(2-ethylbutan... CAS#:82845-37-2 |
| Literature: Barton, Henryk J.; Paluchowska, Maria H.; Mokrosz, Jerzy L.; Szneler, Edward Synthesis, 1987 , # 2 p. 156 - 158 |
|
~%
N-(2-ethylbutan... CAS#:82845-37-2 |
| Literature: Hill; Degnan Journal of the American Chemical Society, 1940 , vol. 62, p. 1595 |
|
~%
N-(2-ethylbutan... CAS#:82845-37-2 |
| Literature: Hill; Degnan Journal of the American Chemical Society, 1940 , vol. 62, p. 1595 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide? |
| A: The English name of N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide is N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide. |
| Q: What is the polar surface area (PSA) of N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide? |
| A: Polar surface area (PSA) of N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide is 85.49000. |
| Q: What is the molecular weight of N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide? |
| A: Molecular weight of N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide is 269.34000. |
| Q: What is the Chinese name of 82845-37-2? |
| A: Chinese name of 82845-37-2 is 82845-37-2. |
| Q: What is the SMILES notation of N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide? |
| A: SMILES notation of N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide is CCC(CC)C(=O)NC(=O)NC(=O)N1CCCCC1. |
| Q: What is the LogP of N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide? |
| A: LogP of N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide is 2.83690. |
| Q: What are the upstream materials of N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide? |
| A: Related upstream materials(CAS) of N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide: 110-89-4;57-44-3;2736-40-5;2158-03-4;409316-63-8. |
| Q: What is the InChIKey of N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide? |
| A: InChIKey of N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide is OONMQGITNQTLKI-UHFFFAOYSA-N. |
| Q: What is the CAS number of N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide? |
| A: CAS number of N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide is 82845-37-2. |
| Q: What is the molecular formula of N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide? |
| A: Molecular formula of N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide is C13H23N3O3. |