N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide structure
|
Common Name | N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 82845-37-2 | Molecular Weight | 269.34000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H23N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-ethylbutanoylcarbamoyl)piperidine-1-carboxamide |
|---|
| Molecular Formula | C13H23N3O3 |
|---|---|
| Molecular Weight | 269.34000 |
| Exact Mass | 269.17400 |
| PSA | 85.49000 |
| LogP | 2.83690 |
| InChIKey | OONMQGITNQTLKI-UHFFFAOYSA-N |
| SMILES | CCC(CC)C(=O)NC(=O)NC(=O)N1CCCCC1 |
|
~70%
N-(2-ethylbutan... CAS#:82845-37-2 |
| Literature: Barton, Henryk J.; Paluchowska, Maria H.; Mokrosz, Jerzy L.; Szneler, Edward Synthesis, 1987 , # 2 p. 156 - 158 |
|
~%
N-(2-ethylbutan... CAS#:82845-37-2 |
| Literature: Hill; Degnan Journal of the American Chemical Society, 1940 , vol. 62, p. 1595 |
|
~%
N-(2-ethylbutan... CAS#:82845-37-2 |
| Literature: Hill; Degnan Journal of the American Chemical Society, 1940 , vol. 62, p. 1595 |