N-ethyl-1-phenyl-N-prop-2-enylcyclohexan-1-amine
N-ethyl-1-phenyl-N-prop-2-enylcyclohexan-1-amine structure
|
Common Name | N-ethyl-1-phenyl-N-prop-2-enylcyclohexan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 82845-39-4 | Molecular Weight | 243.38700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H25N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-ethyl-1-phenyl-N-prop-2-enylcyclohexan-1-amine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H25N |
|---|---|
| Molecular Weight | 243.38700 |
| Exact Mass | 243.19900 |
| PSA | 3.24000 |
| LogP | 4.35390 |
| InChIKey | WLXNXBJFLLQZLF-UHFFFAOYSA-N |
| SMILES | C=CCN(CC)C1(c2ccccc2)CCCCC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-ethyl-1-pheny... CAS#:82845-39-4 |
| Literature: Kalir; Teomy; Amir; Fuchs; Lee; Holsztynska; Rocki; Domino Journal of Medicinal Chemistry, 1984 , vol. 27, # 10 p. 1267 - 1271 |
|
~%
N-ethyl-1-pheny... CAS#:82845-39-4 |
| Literature: Kalir; Teomy; Amir; Fuchs; Lee; Holsztynska; Rocki; Domino Journal of Medicinal Chemistry, 1984 , vol. 27, # 10 p. 1267 - 1271 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-allyl-N-ethyl-1-phenylcyclohexylamine |
| Cyclohexanamine,N-ethyl-1-phenyl-N-2-propenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does N-ethyl-1-phenyl-N-prop-2-enylcyclohexan-1-amine have? |
| A: English synonyms of N-ethyl-1-phenyl-N-prop-2-enylcyclohexan-1-amine: N-allyl-N-ethyl-1-phenylcyclohexylamine, Cyclohexanamine,N-ethyl-1-phenyl-N-2-propenyl. |
| Q: What is the Chinese name of 82845-39-4? |
| A: Chinese name of 82845-39-4 is 82845-39-4. |
| Q: What is the molecular weight of N-ethyl-1-phenyl-N-prop-2-enylcyclohexan-1-amine? |
| A: Molecular weight of N-ethyl-1-phenyl-N-prop-2-enylcyclohexan-1-amine is 243.38700. |
| Q: What are the upstream materials of N-ethyl-1-phenyl-N-prop-2-enylcyclohexan-1-amine? |
| A: Related upstream materials(CAS) of N-ethyl-1-phenyl-N-prop-2-enylcyclohexan-1-amine: 22912-24-9;108-94-1. |
| Q: What is the polar surface area (PSA) of N-ethyl-1-phenyl-N-prop-2-enylcyclohexan-1-amine? |
| A: Polar surface area (PSA) of N-ethyl-1-phenyl-N-prop-2-enylcyclohexan-1-amine is 3.24000. |
| Q: What is the CAS number of N-ethyl-1-phenyl-N-prop-2-enylcyclohexan-1-amine? |
| A: CAS number of N-ethyl-1-phenyl-N-prop-2-enylcyclohexan-1-amine is 82845-39-4. |
| Q: What is the SMILES notation of N-ethyl-1-phenyl-N-prop-2-enylcyclohexan-1-amine? |
| A: SMILES notation of N-ethyl-1-phenyl-N-prop-2-enylcyclohexan-1-amine is C=CCN(CC)C1(c2ccccc2)CCCCC1. |
| Q: What is the LogP of N-ethyl-1-phenyl-N-prop-2-enylcyclohexan-1-amine? |
| A: LogP of N-ethyl-1-phenyl-N-prop-2-enylcyclohexan-1-amine is 4.35390. |
| Q: What is the English name of N-ethyl-1-phenyl-N-prop-2-enylcyclohexan-1-amine? |
| A: The English name of N-ethyl-1-phenyl-N-prop-2-enylcyclohexan-1-amine is N-ethyl-1-phenyl-N-prop-2-enylcyclohexan-1-amine. |
| Q: What is the molecular formula of N-ethyl-1-phenyl-N-prop-2-enylcyclohexan-1-amine? |
| A: Molecular formula of N-ethyl-1-phenyl-N-prop-2-enylcyclohexan-1-amine is C17H25N. |