(R)-(-)-Combretastatin
Modify Date: 2025-09-08 16:48:13
(R)-(-)-Combretastatin structure
|
Common Name | (R)-(-)-Combretastatin | ||
|---|---|---|---|---|
| CAS Number | 82855-09-2 | Molecular Weight | 334.36400 | |
| Density | 1.213g/cm3 | Boiling Point | 485.262ºC at 760 mmHg | |
| Molecular Formula | C18H22O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.278ºC | |
| Name | 5-[2-hydroxy-2-(3,4,5-trimethoxyphenyl)ethyl]-2-methoxyphenol |
|---|
| Density | 1.213g/cm3 |
|---|---|
| Boiling Point | 485.262ºC at 760 mmHg |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.36400 |
| Flash Point | 247.278ºC |
| Exact Mass | 334.14200 |
| PSA | 77.38000 |
| LogP | 2.70270 |
| Index of Refraction | 1.57 |
| InChIKey | LGZKGOGODCLQHG-CYBMUJFWSA-N |
| SMILES | COc1ccc(CC(O)c2cc(OC)c(OC)c(OC)c2)cc1O |
| HS Code | 2909500000 |
|---|
| HS Code | 2909500000 |
|---|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |