2-(4-methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide structure
|
Common Name | 2-(4-methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 82875-44-3 | Molecular Weight | 248.30100 | |
| Density | 1.264g/cm3 | Boiling Point | 447.1ºC at 760 mmHg | |
| Molecular Formula | C12H12N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.2ºC | |
| Name | 2-(4-methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide |
|---|
| Density | 1.264g/cm3 |
|---|---|
| Boiling Point | 447.1ºC at 760 mmHg |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.30100 |
| Flash Point | 224.2ºC |
| Exact Mass | 248.06200 |
| PSA | 94.44000 |
| LogP | 3.11020 |
| Index of Refraction | 1.606 |
| InChIKey | GEXIUKNFKXMXHI-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2nc(C)c(C(N)=O)s2)cc1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |