dimethyl-phenyl-(2-phenylsulfanylethyl)silane structure
|
Common Name | dimethyl-phenyl-(2-phenylsulfanylethyl)silane | ||
|---|---|---|---|---|
| CAS Number | 828915-77-1 | Molecular Weight | 272.48100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20SSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl-phenyl-(2-phenylsulfanylethyl)silane |
|---|
| Molecular Formula | C16H20SSi |
|---|---|
| Molecular Weight | 272.48100 |
| Exact Mass | 272.10500 |
| PSA | 25.30000 |
| LogP | 4.39430 |
| InChIKey | DKTNRDRVLGVTRA-UHFFFAOYSA-N |
| SMILES | C[Si](C)(CCSc1ccccc1)c1ccccc1 |
|
~87%
dimethyl-phenyl... CAS#:828915-77-1 |
| Literature: Merten, Joern; Hennig, Andre; Schwab, Pia; Froehlich, Roland; Tokalov, Sergey V.; Gutzeit, Herwig O.; Metz, Peter European Journal of Organic Chemistry, 2006 , # 5 p. 1144 - 1161 |
|
~%
dimethyl-phenyl... CAS#:828915-77-1 |
| Literature: Merten, Joern; Hennig, Andre; Schwab, Pia; Froehlich, Roland; Tokalov, Sergey V.; Gutzeit, Herwig O.; Metz, Peter European Journal of Organic Chemistry, 2006 , # 5 p. 1144 - 1161 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |