3-(3,3,4-trimethylpent-4-enylidene)-2-benzofuran-1-one structure
|
Common Name | 3-(3,3,4-trimethylpent-4-enylidene)-2-benzofuran-1-one | ||
|---|---|---|---|---|
| CAS Number | 82893-50-3 | Molecular Weight | 242.31300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(3,3,4-trimethylpent-4-enylidene)-2-benzofuran-1-one |
|---|
| Molecular Formula | C16H18O2 |
|---|---|
| Molecular Weight | 242.31300 |
| Exact Mass | 242.13100 |
| PSA | 26.30000 |
| LogP | 4.19030 |
| InChIKey | HWCNSAANURAADK-UHFFFAOYSA-N |
| SMILES | C=C(C)C(C)(C)CC=C1OC(=O)c2ccccc21 |
|
~9%
3-(3,3,4-trimet... CAS#:82893-50-3
Detail
|
| Literature: Osuka, Atsuhiro; Shimizu, Hirohito; Suzuki, Hitomi; Maruyama, Kazuhiro Chemistry Letters, 1982 , p. 329 - 332 |
|
~%
3-(3,3,4-trimet... CAS#:82893-50-3 |
| Literature: Osuka, Atsuhiro; Shimizu, Hirohito; Chiba, Marli H.; Suzuki, Hitomi; Maruyama, Kazuhiro Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 2037 - 2044 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |