3,4-bis(trifluoromethyl)-1H-pyrrole structure
|
Common Name | 3,4-bis(trifluoromethyl)-1H-pyrrole | ||
|---|---|---|---|---|
| CAS Number | 82912-41-2 | Molecular Weight | 203.08500 | |
| Density | 1.506g/cm3 | Boiling Point | 152.8ºC at 760 mmHg | |
| Molecular Formula | C6H3F6N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 46.2ºC | |
| Name | 3,4-bis(trifluoromethyl)-1H-pyrrole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.506g/cm3 |
|---|---|
| Boiling Point | 152.8ºC at 760 mmHg |
| Molecular Formula | C6H3F6N |
| Molecular Weight | 203.08500 |
| Flash Point | 46.2ºC |
| Exact Mass | 203.01700 |
| PSA | 15.79000 |
| LogP | 3.05230 |
| Index of Refraction | 1.372 |
| InChIKey | MEXIJEVOUWNEMH-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1c[nH]cc1C(F)(F)F |
|
~87%
3,4-bis(trifluo... CAS#:82912-41-2 |
| Literature: Kaesler, Ralph W.; LeGoff, Eugene Journal of Organic Chemistry, 1982 , vol. 47, # 24 p. 4779 - 4780 |
|
~78%
3,4-bis(trifluo... CAS#:82912-41-2 |
| Literature: Leroy, Jacques; Cantacuzene, Daniele; Wakselman, Claude Synthesis, 1982 , # 4 p. 313 - 315 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,4-bis(trifluormethyl)-1H-pyrrol |
| 3,4-bis(trifluoromethyl)pyrrole |
| 3,4-Bis<trifluoromethyl>-1H-pyrrole |