2H-Azeto[2,1-a]isoquinolin-2-one, 1,4,5,9b-tetrahydro-1,7,8-trimethoxy-1-methyl- structure
|
Common Name | 2H-Azeto[2,1-a]isoquinolin-2-one, 1,4,5,9b-tetrahydro-1,7,8-trimethoxy-1-methyl- | ||
|---|---|---|---|---|
| CAS Number | 82919-01-5 | Molecular Weight | 277.31600 | |
| Density | 1.24g/cm3 | Boiling Point | 422ºC at 760 mmHg | |
| Molecular Formula | C15H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209ºC | |
| Name | 1,7,8-trimethoxy-1-methyl-5,9b-dihydro-4H-azeto[2,1-a]isoquinolin-2-one |
|---|
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 422ºC at 760 mmHg |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.31600 |
| Flash Point | 209ºC |
| Exact Mass | 277.13100 |
| PSA | 48.00000 |
| LogP | 1.48620 |
| Index of Refraction | 1.576 |
| InChIKey | QXPVNSLTZUYJMQ-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)C1N(CC2)C(=O)C1(C)OC |
|
~45%
2H-Azeto[2,1-a]... CAS#:82919-01-5 |
| Literature: Hegedus; McGuire; Schultze; et al. Journal of the American Chemical Society, 1984 , vol. 106, # 9 p. 2680 - 2687 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |