2',2',5,5,6',6',7,7-octamethylspiro[1,3-benzoxaselenole-2,4'-cyclohexane]-1',3',4,5',6-pentone structure
|
Common Name | 2',2',5,5,6',6',7,7-octamethylspiro[1,3-benzoxaselenole-2,4'-cyclohexane]-1',3',4,5',6-pentone | ||
|---|---|---|---|---|
| CAS Number | 82968-93-2 | Molecular Weight | 439.36100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H24O6Se | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2',2',5,5,6',6',7,7-octamethylspiro[1,3-benzoxaselenole-2,4'-cyclohexane]-1',3',4,5',6-pentone |
|---|
| Molecular Formula | C20H24O6Se |
|---|---|
| Molecular Weight | 439.36100 |
| Exact Mass | 440.07400 |
| PSA | 94.58000 |
| LogP | 2.02610 |
| InChIKey | VSRGMJCRYRRBCM-UHFFFAOYSA-N |
| SMILES | CC1(C)C(=O)C2=C(OC3([Se]2)C(=O)C(C)(C)C(=O)C(C)(C)C3=O)C(C)(C)C1=O |
|
~82%
2',2',5,5,6',6'... CAS#:82968-93-2 |
| Literature: Laitalainen, Tarja; Simonen, Tapio; Kivekaes, Raikko; Klinga, Martti Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 333 - 340 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |