3-methyl-2-nitrobenzo[f][1]benzofuran-4,9-dione structure
|
Common Name | 3-methyl-2-nitrobenzo[f][1]benzofuran-4,9-dione | ||
|---|---|---|---|---|
| CAS Number | 82972-62-1 | Molecular Weight | 257.19800 | |
| Density | 1.513g/cm3 | Boiling Point | 472.9ºC at 760 mmHg | |
| Molecular Formula | C13H7NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.8ºC | |
| Name | 3-methyl-2-nitrobenzo[f][1]benzofuran-4,9-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.513g/cm3 |
|---|---|
| Boiling Point | 472.9ºC at 760 mmHg |
| Molecular Formula | C13H7NO5 |
| Molecular Weight | 257.19800 |
| Flash Point | 239.8ºC |
| Exact Mass | 257.03200 |
| PSA | 93.10000 |
| LogP | 2.79480 |
| Index of Refraction | 1.654 |
| InChIKey | DPEBRUZRUJUEKZ-UHFFFAOYSA-N |
| SMILES | Cc1c([N+](=O)[O-])oc2c1C(=O)c1ccccc1C2=O |
|
~44%
3-methyl-2-nitr... CAS#:82972-62-1 |
| Literature: Lamotte; Demerseman; Buisson; et al. European Journal of Medicinal Chemistry, 1982 , vol. 17, # 3 p. 253 - 256 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Nitro-2 methyl-3 naphto<2,3-b>furannequinone-4,9 |