Mono(2-ethyl-6-hydroxyhexyl) Phthalate structure
|
Common Name | Mono(2-ethyl-6-hydroxyhexyl) Phthalate | ||
|---|---|---|---|---|
| CAS Number | 82975-96-0 | Molecular Weight | 294.34300 | |
| Density | 1.162g/cm3 | Boiling Point | 469.6ºC at 760 mmHg | |
| Molecular Formula | C16H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.1ºC | |
| Name | 2-{[(2-Ethyl-6-hydroxyhexyl)oxy]carbonyl}benzoic acid |
|---|
| Density | 1.162g/cm3 |
|---|---|
| Boiling Point | 469.6ºC at 760 mmHg |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.34300 |
| Flash Point | 169.1ºC |
| Exact Mass | 294.14700 |
| PSA | 83.83000 |
| LogP | 2.73040 |
| Index of Refraction | 1.535 |
| InChIKey | ANOICBHTCMIFJZ-UHFFFAOYSA-M |
| SMILES | CCC(CCCCO)COC(=O)c1ccccc1C(=O)[O-] |
|
~91%
Mono(2-ethyl-6-... CAS#:82975-96-0 |
| Literature: Nuti, Francesca; Hildenbrand, Sibylle; Chelli, Mario; Wodarz, Roman; Papini, Anna Maria Bioorganic and Medicinal Chemistry, 2005 , vol. 13, # 10 p. 3461 - 3465 |
|
~%
Mono(2-ethyl-6-... CAS#:82975-96-0 |
| Literature: Nuti, Francesca; Hildenbrand, Sibylle; Chelli, Mario; Wodarz, Roman; Papini, Anna Maria Bioorganic and Medicinal Chemistry, 2005 , vol. 13, # 10 p. 3461 - 3465 |
|
~%
Mono(2-ethyl-6-... CAS#:82975-96-0 |
| Literature: Nuti, Francesca; Hildenbrand, Sibylle; Chelli, Mario; Wodarz, Roman; Papini, Anna Maria Bioorganic and Medicinal Chemistry, 2005 , vol. 13, # 10 p. 3461 - 3465 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |