amino-12-ethyl-9-pyrrolo<1',2':1,2>pyrazino<6,5-c>carbazole structure
|
Common Name | amino-12-ethyl-9-pyrrolo<1',2':1,2>pyrazino<6,5-c>carbazole | ||
|---|---|---|---|---|
| CAS Number | 82983-02-6 | Molecular Weight | 300.35700 | |
| Density | 1.37g/cm3 | Boiling Point | 547.2ºC at 760 mmHg | |
| Molecular Formula | C19H16N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.7ºC | |
| Name | amino-12-ethyl-9-pyrrolo<1',2':1,2>pyrazino<6,5-c>carbazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 547.2ºC at 760 mmHg |
| Molecular Formula | C19H16N4 |
| Molecular Weight | 300.35700 |
| Flash Point | 284.7ºC |
| Exact Mass | 300.13700 |
| PSA | 48.25000 |
| LogP | 4.77870 |
| Index of Refraction | 1.763 |
| InChIKey | ARHLHTGQNJLJLO-UHFFFAOYSA-N |
| SMILES | CCn1c2ccc(N)cc2c2c3ncc4cccn4c3ccc21 |
|
~69%
amino-12-ethyl-... CAS#:82983-02-6 |
| Literature: Lancelot; Gazengel; Rault; Robba Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 5 p. 1674 - 1679 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| amino-12-ethyl-9-pyrrolo[1',2':1,2]pyrazino[6,5-c]carbazole |
| InChI=1/C19H16N4/c1-2-22-15-6-5-12(20)10-14(15)18-16(22)7-8-17-19(18)21-11-13-4-3-9-23(13)17/h3-11H,2,20H2,1H3 |
| ARHLHTGQNJLJLO-UHFFFAOYSA |