4,5-dihydroxynaphthalene-1-sulphonic acid structure
|
Common Name | 4,5-dihydroxynaphthalene-1-sulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 83-65-8 | Molecular Weight | 240.23300 | |
| Density | 1.677g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H8O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,5-dihydroxynaphthalene-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.677g/cm3 |
|---|---|
| Molecular Formula | C10H8O5S |
| Molecular Weight | 240.23300 |
| Exact Mass | 240.00900 |
| PSA | 103.21000 |
| LogP | 2.57850 |
| Index of Refraction | 1.739 |
| InChIKey | DBTLNKQGKRKJBT-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccc(O)c2c(O)cccc12 |
| HS Code | 2908999090 |
|---|
|
~%
4,5-dihydroxyna... CAS#:83-65-8 |
| Literature: Bayer and Co. Patent: DE80315 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 4, p. 549 |
|
~%
4,5-dihydroxyna... CAS#:83-65-8 |
| Literature: Bayer and Co. Patent: DE67829 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 447,449 Full Text Show Details Bayer and Co. Patent: DE71836 ; Full Text Show Details Bayer and Co. Patent: DE54116 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 2, p. 315 |
|
~%
4,5-dihydroxyna... CAS#:83-65-8 |
| Literature: Bayer and Co. Patent: DE77285 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 4, p. 548 |
|
~%
4,5-dihydroxyna... CAS#:83-65-8 |
| Literature: Cassella and Co. Patent: DE75962 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 4, p. 548 |
|
~%
4,5-dihydroxyna... CAS#:83-65-8 |
| Literature: Bayer and Co. Patent: DE75055 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 452 |
|
~%
4,5-dihydroxyna... CAS#:83-65-8 |
| Literature: Bayer and Co. Patent: DE80667 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 4, p. 549 |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1,8-Dihydroxynaphthalene-4-sulfonic acid |
| 4,5-dihydroxy-naphthalene-1-sulfonic acid |
| 1-Naphthalenesulfonicacid,4,5-dihydroxy |
| 1.8-Dioxy-naphthalin-sulfonsaeure-(4) |
| 4,5-Dihydroxy-1-naphthalenesulfonic acid |
| 4,5-Dihydroxy-naphthalin-1-sulfonsaeure |
| EINECS 201-492-1 |