1-chloro-4-(1,1,2,2,2-pentachloroethyl)benzene structure
|
Common Name | 1-chloro-4-(1,1,2,2,2-pentachloroethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 830-39-7 | Molecular Weight | 312.83500 | |
| Density | 1.629g/cm3 | Boiling Point | 318.6ºC at 760 mmHg | |
| Molecular Formula | C8H4Cl6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.7ºC | |
| Name | 1-chloro-4-(1,1,2,2,2-pentachloroethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.629g/cm3 |
|---|---|
| Boiling Point | 318.6ºC at 760 mmHg |
| Molecular Formula | C8H4Cl6 |
| Molecular Weight | 312.83500 |
| Flash Point | 144.7ºC |
| Exact Mass | 309.84400 |
| LogP | 5.34060 |
| Index of Refraction | 1.586 |
| InChIKey | SPCOQYQEUMJGBW-UHFFFAOYSA-N |
| SMILES | Clc1ccc(C(Cl)(Cl)C(Cl)(Cl)Cl)cc1 |
|
~%
1-chloro-4-(1,1... CAS#:830-39-7 |
| Literature: Woodcock Journal of the Chemical Society, 1949 , p. 203,205 |
|
~%
1-chloro-4-(1,1... CAS#:830-39-7 |
| Literature: Scherer,O.; Hahn,H. Justus Liebigs Annalen der Chemie, 1964 , vol. 677, p. 83 - 95 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Chlor-1-pentachlorethyl-benzol |
| 1-Chlor-4-pentachloraethyl-benzol |
| 1-chloro-4-pentachloroethyl-benzene |