N-allyl-4-chlorobenzenesulfonamide
N-allyl-4-chlorobenzenesulfonamide structure
|
Common Name | N-allyl-4-chlorobenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 830-42-2 | Molecular Weight | 231.69900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-allyl-4-chlorobenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H10ClNO2S |
|---|---|
| Molecular Weight | 231.69900 |
| Exact Mass | 231.01200 |
| PSA | 54.55000 |
| LogP | 3.27600 |
| InChIKey | JQAXQIZINTXLFH-UHFFFAOYSA-N |
| SMILES | C=CCNS(=O)(=O)c1ccc(Cl)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:98-64-6![6-chloro-4-methyl-3,4-dihydro-2H-benzo[1,2]thiazine 1,1-dioxide structure](https://image.chemsrc.com/caspic/397/1208003-96-6.png)
CAS#:1208003-96-6
CAS#:1208004-02-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-[4-Chlor-phenylsulfamino]-prop-1-en |
| N-Ally-p-chlorbenzolsulfonamid |
| N-allyl-p-chlorobenzenesulfonamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does N-allyl-4-chlorobenzenesulfonamide have? |
| A: English synonyms of N-allyl-4-chlorobenzenesulfonamide: 3-[4-Chlor-phenylsulfamino]-prop-1-en, N-Ally-p-chlorbenzolsulfonamid, N-allyl-p-chlorobenzenesulfonamide. |
| Q: What are the downstream products of N-allyl-4-chlorobenzenesulfonamide? |
| A: Related downstream products(CAS) of N-allyl-4-chlorobenzenesulfonamide: 98-64-6;1208003-96-6;1208004-02-7. |
| Q: What is the molecular formula of N-allyl-4-chlorobenzenesulfonamide? |
| A: Molecular formula of N-allyl-4-chlorobenzenesulfonamide is C9H10ClNO2S. |
| Q: What is the CAS number of N-allyl-4-chlorobenzenesulfonamide? |
| A: CAS number of N-allyl-4-chlorobenzenesulfonamide is 830-42-2. |
| Q: What is the LogP of N-allyl-4-chlorobenzenesulfonamide? |
| A: LogP of N-allyl-4-chlorobenzenesulfonamide is 3.27600. |
| Q: What is the SMILES notation of N-allyl-4-chlorobenzenesulfonamide? |
| A: SMILES notation of N-allyl-4-chlorobenzenesulfonamide is C=CCNS(=O)(=O)c1ccc(Cl)cc1. |
| Q: What is the polar surface area (PSA) of N-allyl-4-chlorobenzenesulfonamide? |
| A: Polar surface area (PSA) of N-allyl-4-chlorobenzenesulfonamide is 54.55000. |
| Q: What is the molecular weight of N-allyl-4-chlorobenzenesulfonamide? |
| A: Molecular weight of N-allyl-4-chlorobenzenesulfonamide is 231.69900. |
| Q: What is the InChIKey of N-allyl-4-chlorobenzenesulfonamide? |
| A: InChIKey of N-allyl-4-chlorobenzenesulfonamide is JQAXQIZINTXLFH-UHFFFAOYSA-N. |
| Q: What is the English name of N-allyl-4-chlorobenzenesulfonamide? |
| A: The English name of N-allyl-4-chlorobenzenesulfonamide is N-allyl-4-chlorobenzenesulfonamide. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |