2-Amino-5-(5-bromo-2-iodophenyl)-1,3,4-thiadiazole
Modify Date: 2025-10-07 14:34:55
2-Amino-5-(5-bromo-2-iodophenyl)-1,3,4-thiadiazole structure
|
Common Name | 2-Amino-5-(5-bromo-2-iodophenyl)-1,3,4-thiadiazole | ||
|---|---|---|---|---|
| CAS Number | 830-75-1 | Molecular Weight | 382.02 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5BrIN3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Amino-5-(5-bromo-2-iodophenyl)-1,3,4-thiadiazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H5BrIN3S |
|---|---|
| Molecular Weight | 382.02 |
| InChIKey | JHZBDUYWMCBEFM-UHFFFAOYSA-N |
| SMILES | Nc1nnc(-c2cc(Br)ccc2I)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-Amino-5-(5-bromo-2-iodophenyl)-1,3,4-thiadiazole? |
| A: InChIKey of 2-Amino-5-(5-bromo-2-iodophenyl)-1,3,4-thiadiazole is JHZBDUYWMCBEFM-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-Amino-5-(5-bromo-2-iodophenyl)-1,3,4-thiadiazole? |
| A: Molecular formula of 2-Amino-5-(5-bromo-2-iodophenyl)-1,3,4-thiadiazole is C8H5BrIN3S. |
| Q: What is the CAS number of 2-Amino-5-(5-bromo-2-iodophenyl)-1,3,4-thiadiazole? |
| A: CAS number of 2-Amino-5-(5-bromo-2-iodophenyl)-1,3,4-thiadiazole is 830-75-1. |
| Q: What is the Chinese name of 830-75-1? |
| A: Chinese name of 830-75-1 is 830-75-1. |
| Q: What is the molecular weight of 2-Amino-5-(5-bromo-2-iodophenyl)-1,3,4-thiadiazole? |
| A: Molecular weight of 2-Amino-5-(5-bromo-2-iodophenyl)-1,3,4-thiadiazole is 382.02. |
| Q: What is the SMILES notation of 2-Amino-5-(5-bromo-2-iodophenyl)-1,3,4-thiadiazole? |
| A: SMILES notation of 2-Amino-5-(5-bromo-2-iodophenyl)-1,3,4-thiadiazole is Nc1nnc(-c2cc(Br)ccc2I)s1. |
| Q: What is the English name of 2-Amino-5-(5-bromo-2-iodophenyl)-1,3,4-thiadiazole? |
| A: The English name of 2-Amino-5-(5-bromo-2-iodophenyl)-1,3,4-thiadiazole is 2-Amino-5-(5-bromo-2-iodophenyl)-1,3,4-thiadiazole. |