[2-(trichloromethyl)phenyl] carbonochloridate
![[2-(trichloromethyl)phenyl] carbonochloridate Structure](https://image.chemsrc.com/caspic/012/830-97-7.png)
[2-(trichloromethyl)phenyl] carbonochloridate structure
|
Common Name | [2-(trichloromethyl)phenyl] carbonochloridate | ||
|---|---|---|---|---|
| CAS Number | 830-97-7 | Molecular Weight | 273.92800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H4Cl4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [2-(trichloromethyl)phenyl] carbonochloridate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H4Cl4O2 |
|---|---|
| Molecular Weight | 273.92800 |
| Exact Mass | 271.89700 |
| PSA | 26.30000 |
| LogP | 4.25090 |
| InChIKey | WAZVTVOVPBXTOD-UHFFFAOYSA-N |
| SMILES | O=C(Cl)Oc1ccccc1C(Cl)(Cl)Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
[2-(trichlorome... CAS#:830-97-7 |
| Literature: Scherer,O.; Hahn,H. Justus Liebigs Annalen der Chemie, 1964 , vol. 677, p. 83 - 95 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 1 | |
![[2-(trichloromethyl)phenyl] N-methylcarbamate structure](https://image.chemsrc.com/caspic/481/716-27-8.png)
CAS#:716-27-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Chlorameisensaeure-<2-trichlormethyl-phenylester> |
| Chlorkohlensaeure-<2-trichlormethyl-phenylester> |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of [2-(trichloromethyl)phenyl] carbonochloridate? |
| A: The English name of [2-(trichloromethyl)phenyl] carbonochloridate is [2-(trichloromethyl)phenyl] carbonochloridate. |
| Q: What is the Chinese name of 830-97-7? |
| A: Chinese name of 830-97-7 is 830-97-7. |
| Q: What is the molecular weight of [2-(trichloromethyl)phenyl] carbonochloridate? |
| A: Molecular weight of [2-(trichloromethyl)phenyl] carbonochloridate is 273.92800. |
| Q: What is the LogP of [2-(trichloromethyl)phenyl] carbonochloridate? |
| A: LogP of [2-(trichloromethyl)phenyl] carbonochloridate is 4.25090. |
| Q: What is the molecular formula of [2-(trichloromethyl)phenyl] carbonochloridate? |
| A: Molecular formula of [2-(trichloromethyl)phenyl] carbonochloridate is C8H4Cl4O2. |
| Q: What is the CAS number of [2-(trichloromethyl)phenyl] carbonochloridate? |
| A: CAS number of [2-(trichloromethyl)phenyl] carbonochloridate is 830-97-7. |
| Q: What is the InChIKey of [2-(trichloromethyl)phenyl] carbonochloridate? |
| A: InChIKey of [2-(trichloromethyl)phenyl] carbonochloridate is WAZVTVOVPBXTOD-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of [2-(trichloromethyl)phenyl] carbonochloridate? |
| A: Polar surface area (PSA) of [2-(trichloromethyl)phenyl] carbonochloridate is 26.30000. |
| Q: What are the upstream materials of [2-(trichloromethyl)phenyl] carbonochloridate? |
| A: Related upstream materials(CAS) of [2-(trichloromethyl)phenyl] carbonochloridate: 19358-42-0. |
| Q: What is the SMILES notation of [2-(trichloromethyl)phenyl] carbonochloridate? |
| A: SMILES notation of [2-(trichloromethyl)phenyl] carbonochloridate is O=C(Cl)Oc1ccccc1C(Cl)(Cl)Cl. |