Methyl 2-(benzyloxycarbonylamino)-2-dimethoxyphosphoryl-acetate structure
|
Common Name | Methyl 2-(benzyloxycarbonylamino)-2-dimethoxyphosphoryl-acetate | ||
|---|---|---|---|---|
| CAS Number | 83026-99-7 | Molecular Weight | 331.25800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18NO7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 2-(benzyloxycarbonylamino)-2-dimethoxyphosphoryl-acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H18NO7P |
|---|---|
| Molecular Weight | 331.25800 |
| Exact Mass | 331.08200 |
| PSA | 109.97000 |
| LogP | 2.28870 |
| InChIKey | OZBQRVNDIMNQBJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(NC(=O)OCc1ccccc1)P(=O)(OCC)OCC |
|
~79%
Methyl 2-(benzy... CAS#:83026-99-7 |
| Literature: Ferris, Leigh; Haigh, David; Moody, Christopher J. Journal of the Chemical Society - Perkin Transactions 1, 1996 , # 24 p. 2885 - 2888 |
|
~%
Methyl 2-(benzy... CAS#:83026-99-7 |
| Literature: Schmidt, Ulrich; Lieberknecht, Albrecht; Schanbacher, Ute; Beuttler, Thomas; Wild, Jochen Angewandte Chemie, 1982 , vol. 94, # 10 p. 797 - 798 |
|
~%
Methyl 2-(benzy... CAS#:83026-99-7 |
| Literature: Schmidt, Ulrich; Lieberknecht, Albrecht; Schanbacher, Ute; Beuttler, Thomas; Wild, Jochen Angewandte Chemie, 1982 , vol. 94, # 10 p. 797 - 798 |
| 2-Benzyloxycarbonylamino-2-diethyloxyphosphoryl-essigsaeure-ethylester |
| N-Benzyloxycarbonyl-2-(diethoxyphosphinyl)-glycine ethyl ester |
| (2S)-{[(benzyloxy)carbonyl]amino}(4-hydroxyphenyl)ethanoic acid |
| (2R)-{[(benzyloxy)carbonyl]amino}(4-hydroxyphenyl)ethanoic acid |
| Ethyl 2-benzyloxycarbonylamino-2-(diethoxyphosphoryl)acetate |
| 2-(Cbz-amino)-2-(4'-hydroxyphenyl)acetic acid |
| N-benzyloxycarbonyl-2-(4-hydroxyphenyl)glycine |
| ethyl 2-benzyloxycarbonylamino-2-(diethoxyphosphinyl)-acetate |
| N-Benzyloxycarbonyl-p-hydroxyphenylglycin |