L-Serine,O-benzoyl
Modify Date: 2026-03-16 14:41:24
L-Serine,O-benzoyl structure
|
Common Name | L-Serine,O-benzoyl | ||
|---|---|---|---|---|
| CAS Number | 83044-84-2 | Molecular Weight | 209.19900 | |
| Density | 1.315g/cm3 | Boiling Point | 398.9ºC at 760 mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195ºC | |
| Name | 2-amino-3-benzoyloxypropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.315g/cm3 |
|---|---|
| Boiling Point | 398.9ºC at 760 mmHg |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.19900 |
| Flash Point | 195ºC |
| Exact Mass | 209.06900 |
| PSA | 89.62000 |
| LogP | 0.95560 |
| Index of Refraction | 1.572 |
| InChIKey | ZQXBXSLGROYFDW-UHFFFAOYSA-N |
| SMILES | NC(COC(=O)c1ccccc1)C(=O)O |
| HS Code | 2922509090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:4582-71-2| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| O-benzoyl-DL-serine |
| O-benzoyl-serine |
| O-Benzoyl-serin |
| O-Benzoyl-dl-serin |
| O-Benzoyl-L-serine |