Isonitrinic acid F
Modify Date: 2026-07-04 06:30:00
Isonitrinic acid F structure
|
Common Name | Isonitrinic acid F | ||
|---|---|---|---|---|
| CAS Number | 83052-87-3 | Molecular Weight | 167.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Isonitrinic acid F |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H13NO2 |
|---|---|
| Molecular Weight | 167.20 |
| InChIKey | HKRXZYVRWPLHPW-UHFFFAOYSA-N |
| SMILES | [C-]#[N+]C1CCC(CCC(=O)O)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Isonitrinic acid F? |
| A: SMILES notation of Isonitrinic acid F is [C-]#[N+]C1CCC(CCC(=O)O)C1. |
| Q: What is the InChIKey of Isonitrinic acid F? |
| A: InChIKey of Isonitrinic acid F is HKRXZYVRWPLHPW-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 83052-87-3? |
| A: Chinese name of 83052-87-3 is 83052-87-3. |
| Q: What is the English name of Isonitrinic acid F? |
| A: The English name of Isonitrinic acid F is Isonitrinic acid F. |
| Q: What is the molecular formula of Isonitrinic acid F? |
| A: Molecular formula of Isonitrinic acid F is C9H13NO2. |
| Q: What is the molecular weight of Isonitrinic acid F? |
| A: Molecular weight of Isonitrinic acid F is 167.20. |
| Q: What is the CAS number of Isonitrinic acid F? |
| A: CAS number of Isonitrinic acid F is 83052-87-3. |