ethyl 2-[6-methoxy-2-[(5-nitro-2-furyl)methylidenehydrazinylidene]benzothiazol-3-yl]acetate structure
|
Common Name | ethyl 2-[6-methoxy-2-[(5-nitro-2-furyl)methylidenehydrazinylidene]benzothiazol-3-yl]acetate | ||
|---|---|---|---|---|
| CAS Number | 83132-52-9 | Molecular Weight | 404.39700 | |
| Density | 1.46g/cm3 | Boiling Point | 576.6ºC at 760 mmHg | |
| Molecular Formula | C17H16N4O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 302.5ºC | |
| Name | ethyl 2-[(2Z)-6-methoxy-2-[(E)-(5-nitrofuran-2-yl)methylidenehydrazinylidene]-1,3-benzothiazol-3-yl]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 576.6ºC at 760 mmHg |
| Molecular Formula | C17H16N4O6S |
| Molecular Weight | 404.39700 |
| Flash Point | 302.5ºC |
| Exact Mass | 404.07900 |
| PSA | 152.38000 |
| LogP | 3.23370 |
| Index of Refraction | 1.657 |
| InChIKey | JUVDGNAUPQZDTB-VRNLORSTSA-N |
| SMILES | CCOC(=O)Cn1c(=NN=Cc2ccc([N+](=O)[O-])o2)sc2cc(OC)ccc21 |
|
~89%
ethyl 2-[6-meth... CAS#:83132-52-9 |
| Literature: Kazanis; Macheras; Legakis European Journal of Medicinal Chemistry, 1982 , vol. 17, # 3 p. 291 - 292 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3(2H)-Benzothiazoleacetic acid,ethyl ester |