5-[(3-methoxy-4-phenylmethoxy-phenyl)methyl]pyrimidine-2,4-diamine structure
|
Common Name | 5-[(3-methoxy-4-phenylmethoxy-phenyl)methyl]pyrimidine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 83158-06-9 | Molecular Weight | 336.38800 | |
| Density | 1.252g/cm3 | Boiling Point | 589.4ºC at 760 mmHg | |
| Molecular Formula | C19H20N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 310.2ºC | |
| Name | 5-[(3-methoxy-4-phenylmethoxyphenyl)methyl]pyrimidine-2,4-diamine |
|---|
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 589.4ºC at 760 mmHg |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.38800 |
| Flash Point | 310.2ºC |
| Exact Mass | 336.15900 |
| PSA | 97.74000 |
| LogP | 2.67960 |
| Index of Refraction | 1.65 |
| InChIKey | KRZXDTYOZAQOGL-UHFFFAOYSA-N |
| SMILES | COc1cc(Cc2cnc(N)nc2N)ccc1OCc1ccccc1 |
| HS Code | 2933599090 |
|---|
|
~69%
5-[(3-methoxy-4... CAS#:83158-06-9 |
| Literature: Hachtel; Haller; Seydel Arzneimittel-Forschung/Drug Research, 1988 , vol. 38, # 12 p. 1778 - 1783 |
|
~%
5-[(3-methoxy-4... CAS#:83158-06-9 |
| Literature: Hachtel; Haller; Seydel Arzneimittel-Forschung/Drug Research, 1988 , vol. 38, # 12 p. 1778 - 1783 |
|
~%
5-[(3-methoxy-4... CAS#:83158-06-9 |
| Literature: Hachtel; Haller; Seydel Arzneimittel-Forschung/Drug Research, 1988 , vol. 38, # 12 p. 1778 - 1783 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |